C27H22O2 — CID 67050058
2,7-bis(4-methoxyphenyl)-9H-fluorene (PubChem CID 67050058) has the molecular formula C27H22O2 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2,7-bis(4-methoxyphenyl)-9H-fluorene.
| Compound Name | 2,7-bis(4-methoxyphenyl)-9H-fluorene |
|---|---|
| PubChem CID | 67050058 |
| Molecular Formula | C27H22O2 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2,7-bis(4-methoxyphenyl)-9H-fluorene |
| SMILES | COc1ccc(-c2ccc3c(c2)Cc2cc(-c4ccc(OC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C27H22O2/c1-28-24-9-3-18(4-10-24)20-7-13-26-22(15-20)17-23-16-21(8-14-27(23)26)19-5-11-25(29-2)12-6-19/h3-16H,17H2,1-2H3 |
| InChIKey | ILTVZDDCBFTTOB-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |