C21H20O3 — CID 102598609
1-methoxy-2,4-bis(4-methoxyphenyl)benzene (PubChem CID 102598609) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-methoxy-2,4-bis(4-methoxyphenyl)benzene.
| Compound Name | 1-methoxy-2,4-bis(4-methoxyphenyl)benzene |
|---|---|
| PubChem CID | 102598609 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-methoxy-2,4-bis(4-methoxyphenyl)benzene |
| SMILES | COc1ccc(-c2ccc(OC)c(-c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C21H20O3/c1-22-18-9-4-15(5-10-18)17-8-13-21(24-3)20(14-17)16-6-11-19(23-2)12-7-16/h4-14H,1-3H3 |
| InChIKey | IUANPZKXMGCGHL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |