About 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one
2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one (PubChem CID 174663603) has the molecular formula C8H6O2
and a molecular weight of 134.13 g/mol. Its IUPAC name is 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one.
Analyze 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one?
The IUPAC name of 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one (CID 174663603) is 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one.
What is the SMILES notation for 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one?
The canonical SMILES for 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one is COc1ccc2cc1C2=O.
What is the InChIKey of 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one?
The InChIKey is CGZNPWUWIPDYPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2/c1-10-7-3-2-5-4-6(7)8(5)9/h2-4H,1H3.
What are the key properties of 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one?
2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one has a molecular weight of 134.13 g/mol, XLogP of 1.24, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxybicyclo[3.1.1]hepta-1,3,5(7)-trien-6-one is sourced from PubChem (CID 174663603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).