C50H40N4O10 — CID 170781812
1,4,8,11-tetrakis(3,4-dimethoxyphenyl)quinoxalino[2,3-b]phenazine-6,13-dione (PubChem CID 170781812) has the molecular formula C50H40N4O10 and a molecular weight of 856.89 g/mol. Its IUPAC name is 1,4,8,11-tetrakis(3,4-dimethoxyphenyl)quinoxalino[2,3-b]phenazine-6,13-dione.
| Compound Name | 1,4,8,11-tetrakis(3,4-dimethoxyphenyl)quinoxalino[2,3-b]phenazine-6,13-dione |
|---|---|
| PubChem CID | 170781812 |
| Molecular Formula | C50H40N4O10 |
| Molecular Weight | 856.89 g/mol |
| Exact Mass | 856.27 |
| IUPAC Name | 1,4,8,11-tetrakis(3,4-dimethoxyphenyl)quinoxalino[2,3-b]phenazine-6,13-dione |
| SMILES | COc1ccc(-c2ccc(-c3ccc(OC)c(OC)c3)c3nc4c(nc23)C(=O)c2nc3c(-c5ccc(OC)c(OC)c5)ccc(-c5ccc(OC)c(OC)c5)c3nc2C4=O)cc1OC |
| InChI | InChI=1S/C50H40N4O10/c1-57-33-17-9-25(21-37(33)61-5)29-13-14-30(26-10-18-34(58-2)38(22-26)62-6)42-41(29)51-45-46(52-42)50(56)48-47(49(45)55)53-43-31(27-11-19-35(59-3)39(23-27)63-7)15-16-32(44(43)54-48)28-12-20-36(60-4)40(24-28)64-8/h9-24H,1-8H3 |
| InChIKey | XBWXZPUWGKVOEP-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 159.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.89 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|