C15H18N2O2 — CID 123389568
5-(3,4-dimethoxyphenyl)-N,6-dimethylpyridin-2-amine (PubChem CID 123389568) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-N,6-dimethylpyridin-2-amine.
| Compound Name | 5-(3,4-dimethoxyphenyl)-N,6-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 123389568 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-N,6-dimethylpyridin-2-amine |
| SMILES | CNc1ccc(-c2ccc(OC)c(OC)c2)c(C)n1 |
| InChI | InChI=1S/C15H18N2O2/c1-10-12(6-8-15(16-2)17-10)11-5-7-13(18-3)14(9-11)19-4/h5-9H,1-4H3,(H,16,17) |
| InChIKey | WYJIMIUWWLBKMW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |