C13H16N2O2S — CID 116885804
2-(3,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-5-amine (PubChem CID 116885804) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-5-amine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 116885804 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N,4-dimethyl-1,3-thiazol-5-amine |
| SMILES | CNc1sc(-c2ccc(OC)c(OC)c2)nc1C |
| InChI | InChI=1S/C13H16N2O2S/c1-8-12(14-2)18-13(15-8)9-5-6-10(16-3)11(7-9)17-4/h5-7,14H,1-4H3 |
| InChIKey | CXAYPGYBGBUALY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |