C17H17NO2S — CID 95909841
2-(3,4-dimethoxyphenyl)-4,6-dimethyl-1,3-benzothiazole (PubChem CID 95909841) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4,6-dimethyl-1,3-benzothiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4,6-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 95909841 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4,6-dimethyl-1,3-benzothiazole |
| SMILES | COc1ccc(-c2nc3c(C)cc(C)cc3s2)cc1OC |
| InChI | InChI=1S/C17H17NO2S/c1-10-7-11(2)16-15(8-10)21-17(18-16)12-5-6-13(19-3)14(9-12)20-4/h5-9H,1-4H3 |
| InChIKey | VVKJSIVYUSMVFV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |