C17H22O2 — CID 142094347
1,2-dimethoxy-4-(4-methylphenyl)benzene;ethane (PubChem CID 142094347) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 1,2-dimethoxy-4-(4-methylphenyl)benzene;ethane.
| Compound Name | 1,2-dimethoxy-4-(4-methylphenyl)benzene;ethane |
|---|---|
| PubChem CID | 142094347 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1,2-dimethoxy-4-(4-methylphenyl)benzene;ethane |
| SMILES | CC.COc1ccc(-c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C15H16O2.C2H6/c1-11-4-6-12(7-5-11)13-8-9-14(16-2)15(10-13)17-3;1-2/h4-10H,1-3H3;1-2H3 |
| InChIKey | QZYFFCNTNKGQFR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |