C15H13NO2 — CID 11195791
4-(3,4-dimethoxyphenyl)benzonitrile (PubChem CID 11195791) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)benzonitrile.
| Compound Name | 4-(3,4-dimethoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 11195791 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)benzonitrile |
| SMILES | COc1ccc(-c2ccc(C#N)cc2)cc1OC |
| InChI | InChI=1S/C15H13NO2/c1-17-14-8-7-13(9-15(14)18-2)12-5-3-11(10-16)4-6-12/h3-9H,1-2H3 |
| InChIKey | XRKUYOJPUZGALZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |