C15H12ClNO2 — CID 172993862
3-chloro-5-(3,4-dimethoxyphenyl)benzonitrile (PubChem CID 172993862) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-chloro-5-(3,4-dimethoxyphenyl)benzonitrile.
| Compound Name | 3-chloro-5-(3,4-dimethoxyphenyl)benzonitrile |
|---|---|
| PubChem CID | 172993862 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-chloro-5-(3,4-dimethoxyphenyl)benzonitrile |
| SMILES | COc1ccc(-c2cc(Cl)cc(C#N)c2)cc1OC |
| InChI | InChI=1S/C15H12ClNO2/c1-18-14-4-3-11(8-15(14)19-2)12-5-10(9-17)6-13(16)7-12/h3-8H,1-2H3 |
| InChIKey | BHMLNWHULBIIRF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |