C13H10ClN3O2 — CID 39374773
2-chloro-6-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile (PubChem CID 39374773) has the molecular formula C13H10ClN3O2 and a molecular weight of 275.70 g/mol. Its IUPAC name is 2-chloro-6-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile.
| Compound Name | 2-chloro-6-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 39374773 |
| Molecular Formula | C13H10ClN3O2 |
| Molecular Weight | 275.70 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 2-chloro-6-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile |
| SMILES | COc1ccc(-c2cc(C#N)nc(Cl)n2)cc1OC |
| InChI | InChI=1S/C13H10ClN3O2/c1-18-11-4-3-8(5-12(11)19-2)10-6-9(7-15)16-13(14)17-10/h3-6H,1-2H3 |
| InChIKey | PRHJERPXWCYKOY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.70 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |