C13H12N4O2 — CID 116862627
6-amino-2-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile (PubChem CID 116862627) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 6-amino-2-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile.
| Compound Name | 6-amino-2-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile |
|---|---|
| PubChem CID | 116862627 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 6-amino-2-(3,4-dimethoxyphenyl)pyrimidine-4-carbonitrile |
| SMILES | COc1ccc(-c2nc(N)cc(C#N)n2)cc1OC |
| InChI | InChI=1S/C13H12N4O2/c1-18-10-4-3-8(5-11(10)19-2)13-16-9(7-14)6-12(15)17-13/h3-6H,1-2H3,(H2,15,16,17) |
| InChIKey | AMVFIHGOXRIDLA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |