C18H16Cl2N4O2 — CID 53214677
4-N-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 53214677) has the molecular formula C18H16Cl2N4O2 and a molecular weight of 391.26 g/mol. Its IUPAC name is 4-N-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 53214677 |
| Molecular Formula | C18H16Cl2N4O2 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-N-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(-c2nc(N)cc(Nc3cc(Cl)cc(Cl)c3)n2)cc1OC |
| InChI | InChI=1S/C18H16Cl2N4O2/c1-25-14-4-3-10(5-15(14)26-2)18-23-16(21)9-17(24-18)22-13-7-11(19)6-12(20)8-13/h3-9H,1-2H3,(H3,21,22,23,24) |
| InChIKey | MBMAIBYQGWLJBJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |