C18H17ClN4O2 — CID 53214673
4-N-(3-chlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine (PubChem CID 53214673) has the molecular formula C18H17ClN4O2 and a molecular weight of 356.81 g/mol. Its IUPAC name is 4-N-(3-chlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 53214673 |
| Molecular Formula | C18H17ClN4O2 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-N-(3-chlorophenyl)-2-(3,4-dimethoxyphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(-c2nc(N)cc(Nc3cccc(Cl)c3)n2)cc1OC |
| InChI | InChI=1S/C18H17ClN4O2/c1-24-14-7-6-11(8-15(14)25-2)18-22-16(20)10-17(23-18)21-13-5-3-4-12(19)9-13/h3-10H,1-2H3,(H3,20,21,22,23) |
| InChIKey | ADLUDFHOBYGIJY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |