C13H12ClNO2 — CID 102825072
4-chloro-2-(3,4-dimethoxyphenyl)pyridine (PubChem CID 102825072) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is 4-chloro-2-(3,4-dimethoxyphenyl)pyridine.
| Compound Name | 4-chloro-2-(3,4-dimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 102825072 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-chloro-2-(3,4-dimethoxyphenyl)pyridine |
| SMILES | COc1ccc(-c2cc(Cl)ccn2)cc1OC |
| InChI | InChI=1S/C13H12ClNO2/c1-16-12-4-3-9(7-13(12)17-2)11-8-10(14)5-6-15-11/h3-8H,1-2H3 |
| InChIKey | HSVAVSDCYZBOEM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |