C11H14Cl2N2O2 — CID 139785125
2-(3,4-dimethoxyphenyl)-1H-imidazole;dihydrochloride (PubChem CID 139785125) has the molecular formula C11H14Cl2N2O2 and a molecular weight of 277.15 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1H-imidazole;dihydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1H-imidazole;dihydrochloride |
|---|---|
| PubChem CID | 139785125 |
| Molecular Formula | C11H14Cl2N2O2 |
| Molecular Weight | 277.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1H-imidazole;dihydrochloride |
| SMILES | COc1ccc(-c2ncc[nH]2)cc1OC.Cl.Cl |
| InChI | InChI=1S/C11H12N2O2.2ClH/c1-14-9-4-3-8(7-10(9)15-2)11-12-5-6-13-11;;/h3-7H,1-2H3,(H,12,13);2*1H |
| InChIKey | IINKCXXDSRVVBS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |