C13H12INO2 — CID 138723153
2-(3,4-dimethoxyphenyl)-4-iodopyridine (PubChem CID 138723153) has the molecular formula C13H12INO2 and a molecular weight of 341.15 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-iodopyridine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-iodopyridine |
|---|---|
| PubChem CID | 138723153 |
| Molecular Formula | C13H12INO2 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-iodopyridine |
| SMILES | COc1ccc(-c2cc(I)ccn2)cc1OC |
| InChI | InChI=1S/C13H12INO2/c1-16-12-4-3-9(7-13(12)17-2)11-8-10(14)5-6-15-11/h3-8H,1-2H3 |
| InChIKey | WIRZWSDSSOUFOQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|