C10H9IN2O3 — CID 114771479
2-(3,4-dimethoxyphenyl)-5-iodo-1,3,4-oxadiazole (PubChem CID 114771479) has the molecular formula C10H9IN2O3 and a molecular weight of 332.10 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771479 |
| Molecular Formula | C10H9IN2O3 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-iodo-1,3,4-oxadiazole |
| SMILES | COc1ccc(-c2nnc(I)o2)cc1OC |
| InChI | InChI=1S/C10H9IN2O3/c1-14-7-4-3-6(5-8(7)15-2)9-12-13-10(11)16-9/h3-5H,1-2H3 |
| InChIKey | SIBSWUGQDIWXQY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|