About CID 167685333
CID 167685333 (PubChem CID 167685333) has the molecular formula C13H15N3O3Si
and a molecular weight of 289.37 g/mol.
Molecular Properties
| Compound Name | CID 167685333 |
| PubChem CID | 167685333 |
| Molecular Formula | C13H15N3O3Si |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | — |
| SMILES | COc1ccc(-c2nnc(N=C(C)[Si]C)o2)cc1OC |
| InChI | InChI=1S/C13H15N3O3Si/c1-8(20-4)14-13-16-15-12(19-13)9-5-6-10(17-2)11(7-9)18-3/h5-7H,1-4H3 |
| InChIKey | BXSLBNJAVLQRHH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 167685333 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167685333?
The IUPAC name of CID 167685333 (CID 167685333) is not available.
What is the SMILES notation for CID 167685333?
The canonical SMILES for CID 167685333 is COc1ccc(-c2nnc(N=C(C)[Si]C)o2)cc1OC.
What is the InChIKey of CID 167685333?
The InChIKey is BXSLBNJAVLQRHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O3Si/c1-8(20-4)14-13-16-15-12(19-13)9-5-6-10(17-2)11(7-9)18-3/h5-7H,1-4H3.
What are the key properties of CID 167685333?
CID 167685333 has a molecular weight of 289.37 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167685333 is sourced from PubChem (CID 167685333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).