C12H14N2O5S — CID 56957991
2-(3,4-dimethoxyphenyl)-5-ethylsulfonyl-1,3,4-oxadiazole (PubChem CID 56957991) has the molecular formula C12H14N2O5S and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-ethylsulfonyl-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-ethylsulfonyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 56957991 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-ethylsulfonyl-1,3,4-oxadiazole |
| SMILES | CCS(=O)(=O)c1nnc(-c2ccc(OC)c(OC)c2)o1 |
| InChI | InChI=1S/C12H14N2O5S/c1-4-20(15,16)12-14-13-11(19-12)8-5-6-9(17-2)10(7-8)18-3/h5-7H,4H2,1-3H3 |
| InChIKey | RJOBWIQNMYYXKH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 91.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |