C13H15N3O3S2 — CID 164938861
N-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-bis(methylsulfanyl)methanimine (PubChem CID 164938861) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-bis(methylsulfanyl)methanimine.
| Compound Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-bis(methylsulfanyl)methanimine |
|---|---|
| PubChem CID | 164938861 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-1,1-bis(methylsulfanyl)methanimine |
| SMILES | COc1ccc(-c2nnc(N=C(SC)SC)o2)cc1OC |
| InChI | InChI=1S/C13H15N3O3S2/c1-17-9-6-5-8(7-10(9)18-2)11-15-16-12(19-11)14-13(20-3)21-4/h5-7H,1-4H3 |
| InChIKey | BCCLAGWXUVTKSP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|