C9H6BrIN2O — CID 114771763
2-(3-bromo-4-methylphenyl)-5-iodo-1,3,4-oxadiazole (PubChem CID 114771763) has the molecular formula C9H6BrIN2O and a molecular weight of 364.97 g/mol. Its IUPAC name is 2-(3-bromo-4-methylphenyl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(3-bromo-4-methylphenyl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 114771763 |
| Molecular Formula | C9H6BrIN2O |
| Molecular Weight | 364.97 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | 2-(3-bromo-4-methylphenyl)-5-iodo-1,3,4-oxadiazole |
| SMILES | Cc1ccc(-c2nnc(I)o2)cc1Br |
| InChI | InChI=1S/C9H6BrIN2O/c1-5-2-3-6(4-7(5)10)8-12-13-9(11)14-8/h2-4H,1H3 |
| InChIKey | KGCTUFQJEDABHT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.97 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|