C8H3Br2IN2O — CID 107944229
2-(2,4-dibromophenyl)-5-iodo-1,3,4-oxadiazole (PubChem CID 107944229) has the molecular formula C8H3Br2IN2O and a molecular weight of 429.84 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-5-iodo-1,3,4-oxadiazole.
| Compound Name | 2-(2,4-dibromophenyl)-5-iodo-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 107944229 |
| Molecular Formula | C8H3Br2IN2O |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 427.77 |
| IUPAC Name | 2-(2,4-dibromophenyl)-5-iodo-1,3,4-oxadiazole |
| SMILES | Brc1ccc(-c2nnc(I)o2)c(Br)c1 |
| InChI | InChI=1S/C8H3Br2IN2O/c9-4-1-2-5(6(10)3-4)7-12-13-8(11)14-7/h1-3H |
| InChIKey | WORQCTLCTSAKLD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|