C15H13N3O2 — CID 68916896
6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidine (PubChem CID 68916896) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidine.
| Compound Name | 6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 68916896 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)pyrido[3,2-d]pyrimidine |
| SMILES | COc1ccc(-c2ccc3ncncc3n2)cc1OC |
| InChI | InChI=1S/C15H13N3O2/c1-19-14-6-3-10(7-15(14)20-2)11-4-5-12-13(18-11)8-16-9-17-12/h3-9H,1-2H3 |
| InChIKey | OAPJBOCHXPTRKG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |