C26H27N5O2 — CID 110171978
6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine (PubChem CID 110171978) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine.
| Compound Name | 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 110171978 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 6-(3,4-dimethoxyphenyl)-4-[4-(4-methylphenyl)piperazin-1-yl]pyrido[3,2-d]pyrimidine |
| SMILES | COc1ccc(-c2ccc3ncnc(N4CCN(c5ccc(C)cc5)CC4)c3n2)cc1OC |
| InChI | InChI=1S/C26H27N5O2/c1-18-4-7-20(8-5-18)30-12-14-31(15-13-30)26-25-22(27-17-28-26)10-9-21(29-25)19-6-11-23(32-2)24(16-19)33-3/h4-11,16-17H,12-15H2,1-3H3 |
| InChIKey | WQLYPXWFKLJEMB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|