C25H27N5O2 — CID 20805928
7-(3,4-dimethoxyphenyl)-5-[4-(4-methylphenyl)piperazin-1-yl]imidazo[1,2-c]pyrimidine (PubChem CID 20805928) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-[4-(4-methylphenyl)piperazin-1-yl]imidazo[1,2-c]pyrimidine.
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-[4-(4-methylphenyl)piperazin-1-yl]imidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 20805928 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-[4-(4-methylphenyl)piperazin-1-yl]imidazo[1,2-c]pyrimidine |
| SMILES | COc1ccc(-c2cc3nccn3c(N3CCN(c4ccc(C)cc4)CC3)n2)cc1OC |
| InChI | InChI=1S/C25H27N5O2/c1-18-4-7-20(8-5-18)28-12-14-29(15-13-28)25-27-21(17-24-26-10-11-30(24)25)19-6-9-22(31-2)23(16-19)32-3/h4-11,16-17H,12-15H2,1-3H3 |
| InChIKey | OXGKHQHOCZSBRP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|