C20H18N4O2S — CID 20806044
4-[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]sulfanylaniline (PubChem CID 20806044) has the molecular formula C20H18N4O2S and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]sulfanylaniline.
| Compound Name | 4-[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]sulfanylaniline |
|---|---|
| PubChem CID | 20806044 |
| Molecular Formula | C20H18N4O2S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 4-[7-(3,4-dimethoxyphenyl)imidazo[1,2-c]pyrimidin-5-yl]sulfanylaniline |
| SMILES | COc1ccc(-c2cc3nccn3c(Sc3ccc(N)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H18N4O2S/c1-25-17-8-3-13(11-18(17)26-2)16-12-19-22-9-10-24(19)20(23-16)27-15-6-4-14(21)5-7-15/h3-12H,21H2,1-2H3 |
| InChIKey | DSACWDYHJDABFZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|