C19H21N3O3S — CID 20805884
[4-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl] 2-methylpropanoate (PubChem CID 20805884) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is [4-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl] 2-methylpropanoate.
| Compound Name | [4-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 20805884 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | [4-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl] 2-methylpropanoate |
| SMILES | CCSc1nc(-c2ccc(OC(=O)C(C)C)c(OC)c2)cc2nccn12 |
| InChI | InChI=1S/C19H21N3O3S/c1-5-26-19-21-14(11-17-20-8-9-22(17)19)13-6-7-15(16(10-13)24-4)25-18(23)12(2)3/h6-12H,5H2,1-4H3 |
| InChIKey | MCLQFGOLCJZUML-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|