C21H29N5OS — CID 20806173
N-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl]-N',N'-dimethylbutane-1,4-diamine (PubChem CID 20806173) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is N-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl]-N',N'-dimethylbutane-1,4-diamine.
| Compound Name | N-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl]-N',N'-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 20806173 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenyl]-N',N'-dimethylbutane-1,4-diamine |
| SMILES | CCSc1nc(-c2ccc(OC)c(NCCCCN(C)C)c2)cc2nccn12 |
| InChI | InChI=1S/C21H29N5OS/c1-5-28-21-24-17(15-20-23-11-13-26(20)21)16-8-9-19(27-4)18(14-16)22-10-6-7-12-25(2)3/h8-9,11,13-15,22H,5-7,10,12H2,1-4H3 |
| InChIKey | ZNMZBIDCYVWYEW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 54.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|