C22H28N4O3S — CID 20805814
4-[3-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenoxy]propyl]morpholine (PubChem CID 20805814) has the molecular formula C22H28N4O3S and a molecular weight of 428.56 g/mol. Its IUPAC name is 4-[3-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenoxy]propyl]morpholine.
| Compound Name | 4-[3-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenoxy]propyl]morpholine |
|---|---|
| PubChem CID | 20805814 |
| Molecular Formula | C22H28N4O3S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 4-[3-[5-(5-ethylsulfanylimidazo[1,2-c]pyrimidin-7-yl)-2-methoxyphenoxy]propyl]morpholine |
| SMILES | CCSc1nc(-c2ccc(OC)c(OCCCN3CCOCC3)c2)cc2nccn12 |
| InChI | InChI=1S/C22H28N4O3S/c1-3-30-22-24-18(16-21-23-7-9-26(21)22)17-5-6-19(27-2)20(15-17)29-12-4-8-25-10-13-28-14-11-25/h5-7,9,15-16H,3-4,8,10-14H2,1-2H3 |
| InChIKey | WCNYCTSZFCFUQO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|