C24H27ClN2O4 — CID 162666117
4-[3-[2-(4-chlorophenyl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]morpholine (PubChem CID 162666117) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 4-[3-[2-(4-chlorophenyl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]morpholine.
| Compound Name | 4-[3-[2-(4-chlorophenyl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]morpholine |
|---|---|
| PubChem CID | 162666117 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 4-[3-[2-(4-chlorophenyl)-6,7-dimethoxyquinolin-4-yl]oxypropyl]morpholine |
| SMILES | COc1cc2nc(-c3ccc(Cl)cc3)cc(OCCCN3CCOCC3)c2cc1OC |
| InChI | InChI=1S/C24H27ClN2O4/c1-28-23-14-19-21(16-24(23)29-2)26-20(17-4-6-18(25)7-5-17)15-22(19)31-11-3-8-27-9-12-30-13-10-27/h4-7,14-16H,3,8-13H2,1-2H3 |
| InChIKey | LWPXZNSHSPSWPW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|