C26H29F3N2O4 — CID 162669640
1-[3-[6,7-dimethoxy-2-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxypropyl]piperidin-4-ol (PubChem CID 162669640) has the molecular formula C26H29F3N2O4 and a molecular weight of 490.52 g/mol. Its IUPAC name is 1-[3-[6,7-dimethoxy-2-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxypropyl]piperidin-4-ol.
| Compound Name | 1-[3-[6,7-dimethoxy-2-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 162669640 |
| Molecular Formula | C26H29F3N2O4 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 1-[3-[6,7-dimethoxy-2-[4-(trifluoromethyl)phenyl]quinolin-4-yl]oxypropyl]piperidin-4-ol |
| SMILES | COc1cc2nc(-c3ccc(C(F)(F)F)cc3)cc(OCCCN3CCC(O)CC3)c2cc1OC |
| InChI | InChI=1S/C26H29F3N2O4/c1-33-24-14-20-22(16-25(24)34-2)30-21(17-4-6-18(7-5-17)26(27,28)29)15-23(20)35-13-3-10-31-11-8-19(32)9-12-31/h4-7,14-16,19,32H,3,8-13H2,1-2H3 |
| InChIKey | WTEGMOVJRXPDDD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|