C31H41FN4O5 — CID 23022830
1-(3,3-dimethylbutyl)-3-[2-fluoro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]urea (PubChem CID 23022830) has the molecular formula C31H41FN4O5 and a molecular weight of 568.69 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[2-fluoro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[2-fluoro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 23022830 |
| Molecular Formula | C31H41FN4O5 |
| Molecular Weight | 568.69 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[2-fluoro-4-[7-[3-(4-hydroxypiperidin-1-yl)propoxy]-6-methoxyquinolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NCCC(C)(C)C)c(F)c3)ccnc2cc1OCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C31H41FN4O5/c1-31(2,3)11-13-34-30(38)35-25-7-6-22(18-24(25)32)41-27-8-12-33-26-20-29(28(39-4)19-23(26)27)40-17-5-14-36-15-9-21(37)10-16-36/h6-8,12,18-21,37H,5,9-11,13-17H2,1-4H3,(H2,34,35,38) |
| InChIKey | CPKOLLOMDXKEIV-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 105.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.69 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|