C31H42N4O5 — CID 23022711
1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]urea (PubChem CID 23022711) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]urea.
| Compound Name | 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]urea |
|---|---|
| PubChem CID | 23022711 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3-[4-[6-methoxy-7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]urea |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NCCC(C)(C)C)cc3)ccnc2cc1OCCCCN1CCOCC1 |
| InChI | InChI=1S/C31H42N4O5/c1-31(2,3)12-14-33-30(36)34-23-7-9-24(10-8-23)40-27-11-13-32-26-22-29(28(37-4)21-25(26)27)39-18-6-5-15-35-16-19-38-20-17-35/h7-11,13,21-22H,5-6,12,14-20H2,1-4H3,(H2,33,34,36) |
| InChIKey | STHBAYAOLMLALI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|