C27H33ClN4O5 — CID 22667116
1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-propylurea (PubChem CID 22667116) has the molecular formula C27H33ClN4O5 and a molecular weight of 529.04 g/mol. Its IUPAC name is 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-propylurea.
| Compound Name | 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-propylurea |
|---|---|
| PubChem CID | 22667116 |
| Molecular Formula | C27H33ClN4O5 |
| Molecular Weight | 529.04 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 1-[2-chloro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(Oc2ccnc3cc(OCCCN4CCOCC4)c(OC)cc23)cc1Cl |
| InChI | InChI=1S/C27H33ClN4O5/c1-3-8-30-27(33)31-22-6-5-19(16-21(22)28)37-24-7-9-29-23-18-26(25(34-2)17-20(23)24)36-13-4-10-32-11-14-35-15-12-32/h5-7,9,16-18H,3-4,8,10-15H2,1-2H3,(H2,30,31,33) |
| InChIKey | VGKBAJHJXBKFEY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.04 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|