C25H25ClN4O5 — CID 90349736
1-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-2-chlorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 90349736) has the molecular formula C25H25ClN4O5 and a molecular weight of 496.95 g/mol. Its IUPAC name is 1-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-2-chlorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-2-chlorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 90349736 |
| Molecular Formula | C25H25ClN4O5 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-2-chlorophenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | CCCCOc1cc2nccc(Oc3ccc(NC(=O)Nc4cc(C)on4)c(Cl)c3)c2cc1OC |
| InChI | InChI=1S/C25H25ClN4O5/c1-4-5-10-33-23-14-20-17(13-22(23)32-3)21(8-9-27-20)34-16-6-7-19(18(26)12-16)28-25(31)29-24-11-15(2)35-30-24/h6-9,11-14H,4-5,10H2,1-3H3,(H2,28,29,30,31) |
| InChIKey | HRBIMGZTTRSORV-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|