C22H15ClN4O5 — CID 177059919
1-[2-chloro-4-(6,7-diformylquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea (PubChem CID 177059919) has the molecular formula C22H15ClN4O5 and a molecular weight of 450.84 g/mol. Its IUPAC name is 1-[2-chloro-4-(6,7-diformylquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[2-chloro-4-(6,7-diformylquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 177059919 |
| Molecular Formula | C22H15ClN4O5 |
| Molecular Weight | 450.84 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 1-[2-chloro-4-(6,7-diformylquinolin-4-yl)oxyphenyl]-3-(5-methyl-1,2-oxazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(Oc3ccnc4cc(C=O)c(C=O)cc34)cc2Cl)no1 |
| InChI | InChI=1S/C22H15ClN4O5/c1-12-6-21(27-32-12)26-22(30)25-18-3-2-15(9-17(18)23)31-20-4-5-24-19-8-14(11-29)13(10-28)7-16(19)20/h2-11H,1H3,(H2,25,26,27,30) |
| InChIKey | QBYOIHMAACBZOW-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.84 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|