C24H21ClN2O6 — CID 134334002
ethyl 1-[[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylate (PubChem CID 134334002) has the molecular formula C24H21ClN2O6 and a molecular weight of 468.89 g/mol. Its IUPAC name is ethyl 1-[[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134334002 |
| Molecular Formula | C24H21ClN2O6 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | ethyl 1-[[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]carbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(=O)Nc2ccc(Oc3ccnc4cc(OC)c(C=O)cc34)cc2Cl)CC1 |
| InChI | InChI=1S/C24H21ClN2O6/c1-3-32-23(30)24(7-8-24)22(29)27-18-5-4-15(11-17(18)25)33-20-6-9-26-19-12-21(31-2)14(13-28)10-16(19)20/h4-6,9-13H,3,7-8H2,1-2H3,(H,27,29) |
| InChIKey | GQZZAKYANKNHCR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|