C22H19ClFN3O3S — CID 145166819
N-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-fluoro-3-methylazetidine-1-carbothioamide (PubChem CID 145166819) has the molecular formula C22H19ClFN3O3S and a molecular weight of 459.93 g/mol. Its IUPAC name is N-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-fluoro-3-methylazetidine-1-carbothioamide.
| Compound Name | N-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-fluoro-3-methylazetidine-1-carbothioamide |
|---|---|
| PubChem CID | 145166819 |
| Molecular Formula | C22H19ClFN3O3S |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N-[2-chloro-4-(6-formyl-7-methoxyquinolin-4-yl)oxyphenyl]-3-fluoro-3-methylazetidine-1-carbothioamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)N4CC(C)(F)C4)c(Cl)c3)c2cc1C=O |
| InChI | InChI=1S/C22H19ClFN3O3S/c1-22(24)11-27(12-22)21(31)26-17-4-3-14(8-16(17)23)30-19-5-6-25-18-9-20(29-2)13(10-28)7-15(18)19/h3-10H,11-12H2,1-2H3,(H,26,31) |
| InChIKey | BOFWJEUMLREFPI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|