C24H21ClF2N4O5 — CID 145166619
4-[3-chloro-4-[[2-(2,2-difluoroethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde;methanamine (PubChem CID 145166619) has the molecular formula C24H21ClF2N4O5 and a molecular weight of 518.90 g/mol. Its IUPAC name is 4-[3-chloro-4-[[2-(2,2-difluoroethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde;methanamine.
| Compound Name | 4-[3-chloro-4-[[2-(2,2-difluoroethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 145166619 |
| Molecular Formula | C24H21ClF2N4O5 |
| Molecular Weight | 518.90 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[3-chloro-4-[[2-(2,2-difluoroethylamino)-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carbaldehyde;methanamine |
| SMILES | CN.COc1cc2nccc(Oc3ccc(Nc4c(NCC(F)F)c(=O)c4=O)c(Cl)c3)c2cc1C=O |
| InChI | InChI=1S/C23H16ClF2N3O5.CH5N/c1-33-18-8-16-13(6-11(18)10-30)17(4-5-27-16)34-12-2-3-15(14(24)7-12)29-21-20(22(31)23(21)32)28-9-19(25)26;1-2/h2-8,10,19,28-29H,9H2,1H3;2H2,1H3 |
| InChIKey | UPWXXWGVDUVASM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.90 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|