C25H24ClN5O6 — CID 134334011
4-[3-chloro-4-[[2-[2-(dimethylamino)ethylamino]oxy-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134334011) has the molecular formula C25H24ClN5O6 and a molecular weight of 525.95 g/mol. Its IUPAC name is 4-[3-chloro-4-[[2-[2-(dimethylamino)ethylamino]oxy-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[[2-[2-(dimethylamino)ethylamino]oxy-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134334011 |
| Molecular Formula | C25H24ClN5O6 |
| Molecular Weight | 525.95 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 4-[3-chloro-4-[[2-[2-(dimethylamino)ethylamino]oxy-3,4-dioxocyclobuten-1-yl]amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(Nc4c(ONCCN(C)C)c(=O)c4=O)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C25H24ClN5O6/c1-31(2)9-8-29-37-24-21(22(32)23(24)33)30-17-5-4-13(10-16(17)26)36-19-6-7-28-18-12-20(35-3)15(25(27)34)11-14(18)19/h4-7,10-12,29-30H,8-9H2,1-3H3,(H2,27,34) |
| InChIKey | OUBKGDYSASPRGA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.95 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|