C25H20Cl2N4O3S — CID 134333848
4-[3-chloro-4-[(4-chlorophenyl)methylcarbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134333848) has the molecular formula C25H20Cl2N4O3S and a molecular weight of 527.43 g/mol. Its IUPAC name is 4-[3-chloro-4-[(4-chlorophenyl)methylcarbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[(4-chlorophenyl)methylcarbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134333848 |
| Molecular Formula | C25H20Cl2N4O3S |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 526.06 |
| IUPAC Name | 4-[3-chloro-4-[(4-chlorophenyl)methylcarbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NCc4ccc(Cl)cc4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C25H20Cl2N4O3S/c1-33-23-12-21-17(11-18(23)24(28)32)22(8-9-29-21)34-16-6-7-20(19(27)10-16)31-25(35)30-13-14-2-4-15(26)5-3-14/h2-12H,13H2,1H3,(H2,28,32)(H2,30,31,35) |
| InChIKey | AGWXHSXVWORIPN-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|