C24H22ClN5O3S — CID 145166612
4-[3-chloro-4-(2-ethenyliminobut-3-enylcarbamothioylamino)phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 145166612) has the molecular formula C24H22ClN5O3S and a molecular weight of 495.99 g/mol. Its IUPAC name is 4-[3-chloro-4-(2-ethenyliminobut-3-enylcarbamothioylamino)phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(2-ethenyliminobut-3-enylcarbamothioylamino)phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 145166612 |
| Molecular Formula | C24H22ClN5O3S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 4-[3-chloro-4-(2-ethenyliminobut-3-enylcarbamothioylamino)phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | C=C/N=C(\C=C)CNC(=S)Nc1ccc(Oc2ccnc3cc(OC)c(C(N)=O)cc23)cc1Cl |
| InChI | InChI=1S/C24H22ClN5O3S/c1-4-14(27-5-2)13-29-24(34)30-19-7-6-15(10-18(19)25)33-21-8-9-28-20-12-22(32-3)17(23(26)31)11-16(20)21/h4-12H,1-2,13H2,3H3,(H2,26,31)(H2,29,30,34)/b27-14+ |
| InChIKey | XBGMXPUTWXCYFP-MZJWZYIUSA-N |
| XLogP | 4.84 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|