C21H18ClFN4O3S — CID 134333789
4-[3-chloro-4-[(3-fluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134333789) has the molecular formula C21H18ClFN4O3S and a molecular weight of 460.92 g/mol. Its IUPAC name is 4-[3-chloro-4-[(3-fluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[(3-fluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134333789 |
| Molecular Formula | C21H18ClFN4O3S |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 4-[3-chloro-4-[(3-fluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)N4CC(F)C4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C21H18ClFN4O3S/c1-29-19-8-17-13(7-14(19)20(24)28)18(4-5-25-17)30-12-2-3-16(15(22)6-12)26-21(31)27-9-11(23)10-27/h2-8,11H,9-10H2,1H3,(H2,24,28)(H,26,31) |
| InChIKey | LVQOBPVELAVWAL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|