C22H18ClF3N4O3S — CID 134333929
4-[3-chloro-4-[[1-(trifluoromethyl)cyclopropyl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 134333929) has the molecular formula C22H18ClF3N4O3S and a molecular weight of 510.93 g/mol. Its IUPAC name is 4-[3-chloro-4-[[1-(trifluoromethyl)cyclopropyl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-[[1-(trifluoromethyl)cyclopropyl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 134333929 |
| Molecular Formula | C22H18ClF3N4O3S |
| Molecular Weight | 510.93 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | 4-[3-chloro-4-[[1-(trifluoromethyl)cyclopropyl]carbamothioylamino]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=S)NC4(C(F)(F)F)CC4)c(Cl)c3)c2cc1C(N)=O |
| InChI | InChI=1S/C22H18ClF3N4O3S/c1-32-18-10-16-12(9-13(18)19(27)31)17(4-7-28-16)33-11-2-3-15(14(23)8-11)29-20(34)30-21(5-6-21)22(24,25)26/h2-4,7-10H,5-6H2,1H3,(H2,27,31)(H2,29,30,34) |
| InChIKey | WRIHQARCPSLYAR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.93 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|