C22H18ClF2N3O4S — CID 134333805
methyl 4-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxylate (PubChem CID 134333805) has the molecular formula C22H18ClF2N3O4S and a molecular weight of 493.92 g/mol. Its IUPAC name is methyl 4-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxylate.
| Compound Name | methyl 4-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxylate |
|---|---|
| PubChem CID | 134333805 |
| Molecular Formula | C22H18ClF2N3O4S |
| Molecular Weight | 493.92 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | methyl 4-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]-7-methoxyquinoline-6-carboxylate |
| SMILES | COC(=O)c1cc2c(Oc3ccc(NC(=S)N4CC(F)(F)C4)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C22H18ClF2N3O4S/c1-30-19-9-17-13(8-14(19)20(29)31-2)18(5-6-26-17)32-12-3-4-16(15(23)7-12)27-21(33)28-10-22(24,25)11-28/h3-9H,10-11H2,1-2H3,(H,27,33) |
| InChIKey | WTXBFVAMZTZWRX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.92 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|