C19H16ClN3O5 — CID 155172684
[2-chloro-4-[7-methoxy-6-(methylcarbamoyl)quinolin-4-yl]oxyphenyl]carbamic acid (PubChem CID 155172684) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is [2-chloro-4-[7-methoxy-6-(methylcarbamoyl)quinolin-4-yl]oxyphenyl]carbamic acid.
| Compound Name | [2-chloro-4-[7-methoxy-6-(methylcarbamoyl)quinolin-4-yl]oxyphenyl]carbamic acid |
|---|---|
| PubChem CID | 155172684 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [2-chloro-4-[7-methoxy-6-(methylcarbamoyl)quinolin-4-yl]oxyphenyl]carbamic acid |
| SMILES | CNC(=O)c1cc2c(Oc3ccc(NC(=O)O)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C19H16ClN3O5/c1-21-18(24)12-8-11-15(9-17(12)27-2)22-6-5-16(11)28-10-3-4-14(13(20)7-10)23-19(25)26/h3-9,23H,1-2H3,(H,21,24)(H,25,26) |
| InChIKey | GLTNIKXZMSSNHT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |