C23H25ClN4O5 — CID 11612547
4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-N-(2-ethoxyethyl)-7-methoxyquinoline-6-carboxamide (PubChem CID 11612547) has the molecular formula C23H25ClN4O5 and a molecular weight of 472.93 g/mol. Its IUPAC name is 4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-N-(2-ethoxyethyl)-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-N-(2-ethoxyethyl)-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 11612547 |
| Molecular Formula | C23H25ClN4O5 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 4-[3-chloro-4-(methylcarbamoylamino)phenoxy]-N-(2-ethoxyethyl)-7-methoxyquinoline-6-carboxamide |
| SMILES | CCOCCNC(=O)c1cc2c(Oc3ccc(NC(=O)NC)c(Cl)c3)ccnc2cc1OC |
| InChI | InChI=1S/C23H25ClN4O5/c1-4-32-10-9-27-22(29)16-12-15-19(13-21(16)31-3)26-8-7-20(15)33-14-5-6-18(17(24)11-14)28-23(30)25-2/h5-8,11-13H,4,9-10H2,1-3H3,(H,27,29)(H2,25,28,30) |
| InChIKey | AOKMTGASYSQDSL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|