C25H27ClN4O5 — CID 22936717
4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-N-ethyl-7-(2-methoxyethoxy)quinoline-6-carboxamide (PubChem CID 22936717) has the molecular formula C25H27ClN4O5 and a molecular weight of 498.97 g/mol. Its IUPAC name is 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-N-ethyl-7-(2-methoxyethoxy)quinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-N-ethyl-7-(2-methoxyethoxy)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 22936717 |
| Molecular Formula | C25H27ClN4O5 |
| Molecular Weight | 498.97 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-N-ethyl-7-(2-methoxyethoxy)quinoline-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(Oc3ccc(NC(=O)NC4CC4)c(Cl)c3)ccnc2cc1OCCOC |
| InChI | InChI=1S/C25H27ClN4O5/c1-3-27-24(31)18-13-17-21(14-23(18)34-11-10-33-2)28-9-8-22(17)35-16-6-7-20(19(26)12-16)30-25(32)29-15-4-5-15/h6-9,12-15H,3-5,10-11H2,1-2H3,(H,27,31)(H2,29,30,32) |
| InChIKey | MLJCIQOIWRNSAV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.97 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|