C23H22ClN5O4 — CID 16718953
4-[3-chloro-4-(ethylcarbamoylamino)phenoxy]-N-(2-cyanoethyl)-7-methoxyquinoline-6-carboxamide (PubChem CID 16718953) has the molecular formula C23H22ClN5O4 and a molecular weight of 467.91 g/mol. Its IUPAC name is 4-[3-chloro-4-(ethylcarbamoylamino)phenoxy]-N-(2-cyanoethyl)-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[3-chloro-4-(ethylcarbamoylamino)phenoxy]-N-(2-cyanoethyl)-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 16718953 |
| Molecular Formula | C23H22ClN5O4 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-[3-chloro-4-(ethylcarbamoylamino)phenoxy]-N-(2-cyanoethyl)-7-methoxyquinoline-6-carboxamide |
| SMILES | CCNC(=O)Nc1ccc(Oc2ccnc3cc(OC)c(C(=O)NCCC#N)cc23)cc1Cl |
| InChI | InChI=1S/C23H22ClN5O4/c1-3-26-23(31)29-18-6-5-14(11-17(18)24)33-20-7-10-27-19-13-21(32-2)16(12-15(19)20)22(30)28-9-4-8-25/h5-7,10-13H,3-4,9H2,1-2H3,(H,28,30)(H2,26,29,31) |
| InChIKey | LUYMILYJAJJQPZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|